cas: 790667-99-1 — see every product listed under this CAS number, including other names
(2S,4S)-1-BOC-2-METHYL-4-HYDROXYPIPERIDINE, 97% (CAS 790667-99-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F468049-100MG |
| cas | 790667-99-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 289.50 Pln | |
| Fluorochem | 250mg | 419.66 Pln | |
| Fluorochem | 500mg | 659.16 Pln | |
| Fluorochem | 1g | 981.96 Pln | |
| Fluorochem | 5g | 3314.48 Pln | |
| Fluorochem | 10g | 6266.56 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl (2S,4S)-4-hydroxy-2-methylpiperidine-1-carboxylate (CAS 790667-99-1) is a chemical compound with the molecular formula C11H21NO3 and a molecular weight of 215.29 g/mol. IUPAC name: tert-butyl (2S,4S)-4-hydroxy-2-methylpiperidine-1-carboxylate. InChIKey: RCXJVQLRZJXWNM-IUCAKERBSA-N.
| Molecular formula | C11H21NO3 |
|---|---|
| Molecular weight | 215.29 g/mol |
| IUPAC name | tert-butyl (2S,4S)-4-hydroxy-2-methylpiperidine-1-carboxylate |
| InChIKey | RCXJVQLRZJXWNM-IUCAKERBSA-N |
| SMILES | C[C@H]1C[C@H](CCN1C(=O)OC(C)(C)C)O |
Computed by PubChem (NCBI)