cas: 273221-98-0 — see every product listed under this CAS number, including other names
(2S,4S)-4-(((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)methyl)-1-(tert-butoxycarbonyl)pyrrolidine-2-carboxylic acid, 95% (CAS 273221-98-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 250mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A763935-1g |
| cas | 273221-98-0 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 17842.30 Pln | |
| AmBeed | 250mg | 7178.92 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
(2S,4S)-4-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid (CAS 273221-98-0) is a chemical compound with the molecular formula C26H30N2O6 and a molecular weight of 466.5 g/mol. IUPAC name: (2S,4S)-4-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid. InChIKey: DXBCMCAXZWBWLK-AOMKIAJQSA-N.
| Molecular formula | C26H30N2O6 |
|---|---|
| Molecular weight | 466.5 g/mol |
| IUPAC name | (2S,4S)-4-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid |
| InChIKey | DXBCMCAXZWBWLK-AOMKIAJQSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](C[C@H]1C(=O)O)CNC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)