cas: 281666-44-2 — see every product listed under this CAS number, including other names
(2S,4S)-4-tert-Butoxycarbonylamino-pyrrolidine-1,2-dicarboxylic acid 1-benzyl ester, 95%, 95% (CAS 281666-44-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11CH3Q-1g |
| cas | 281666-44-2 |
| size | 1g |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 750.80 Pln | |
| Chemat | 5g | 2474.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(2S,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-1-phenylmethoxycarbonylpyrrolidine-2-carboxylic acid (CAS 281666-44-2) is a chemical compound with the molecular formula C18H24N2O6 and a molecular weight of 364.4 g/mol. IUPAC name: (2S,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-1-phenylmethoxycarbonylpyrrolidine-2-carboxylic acid. InChIKey: DDWOAECQYPSHMZ-KBPBESRZSA-N.
| Molecular formula | C18H24N2O6 |
|---|---|
| Molecular weight | 364.4 g/mol |
| IUPAC name | (2S,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-1-phenylmethoxycarbonylpyrrolidine-2-carboxylic acid |
| InChIKey | DDWOAECQYPSHMZ-KBPBESRZSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H]1C[C@H](N(C1)C(=O)OCC2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)