cas: 1207852-93-4 — see every product listed under this CAS number, including other names
(2S,4S)-tert-Butyl 2-(difluoromethyl)-4-hydroxypyrrolidine-1-carboxylate 97% (CAS 1207852-93-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A363334-100mg |
| cas | 1207852-93-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 654.06 Pln | |
| Ambeed | 250mg | 1060.12 Pln | |
| Ambeed | 1g | 2734.44 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A363334 |
Tert-butyl (2S,4S)-2-(difluoromethyl)-4-hydroxypyrrolidine-1-carboxylate (CAS 1207852-93-4) is a chemical compound with the molecular formula C10H17F2NO3 and a molecular weight of 237.24 g/mol. IUPAC name: tert-butyl (2S,4S)-2-(difluoromethyl)-4-hydroxypyrrolidine-1-carboxylate. InChIKey: GRUBQHUBZNSRIH-BQBZGAKWSA-N.
| Molecular formula | C10H17F2NO3 |
|---|---|
| Molecular weight | 237.24 g/mol |
| IUPAC name | tert-butyl (2S,4S)-2-(difluoromethyl)-4-hydroxypyrrolidine-1-carboxylate |
| InChIKey | GRUBQHUBZNSRIH-BQBZGAKWSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](C[C@H]1C(F)F)O |
Computed by PubChem (NCBI)