cas: 470482-40-7 — see every product listed under this CAS number, including other names
(2S,4S)-tert-Butyl 2-(hydroxymethyl)-4-(trifluoromethyl)pyrrolidine-1-carboxylate, 97%, 97% (CAS 470482-40-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I9LW-100mg |
| cas | 470482-40-7 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 986.00 Pln | |
| Chemat | 250mg | 1605.20 Pln | |
| Chemat | 500mg | 2637.20 Pln | |
| Chemat | 1g | 3923.60 Pln | |
| Chemat | 5g | 11642.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl (2S,4S)-2-(hydroxymethyl)-4-(trifluoromethyl)pyrrolidine-1-carboxylate (CAS 470482-40-7) is a chemical compound with the molecular formula C11H18F3NO3 and a molecular weight of 269.26 g/mol. IUPAC name: tert-butyl (2S,4S)-2-(hydroxymethyl)-4-(trifluoromethyl)pyrrolidine-1-carboxylate. InChIKey: CRSWFECHMDRHHV-YUMQZZPRSA-N.
| Molecular formula | C11H18F3NO3 |
|---|---|
| Molecular weight | 269.26 g/mol |
| IUPAC name | tert-butyl (2S,4S)-2-(hydroxymethyl)-4-(trifluoromethyl)pyrrolidine-1-carboxylate |
| InChIKey | CRSWFECHMDRHHV-YUMQZZPRSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](C[C@H]1CO)C(F)(F)F |
Computed by PubChem (NCBI)