cas: 540501-56-2 — see every product listed under this CAS number, including other names
(2S,4S)-tert-Butyl 2-(hydroxymethyl)-4-methylpyrrolidine-1-carboxylate, 97%, 97% (CAS 540501-56-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DPPF-100mg |
| cas | 540501-56-2 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 410.00 Pln | |
| Chemat | 250mg | 563.60 Pln | |
| Chemat | 500mg | 1043.60 Pln | |
| Chemat | 1g | 1518.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl (2S,4S)-2-(hydroxymethyl)-4-methylpyrrolidine-1-carboxylate (CAS 540501-56-2) is a chemical compound with the molecular formula C11H21NO3 and a molecular weight of 215.29 g/mol. IUPAC name: tert-butyl (2S,4S)-2-(hydroxymethyl)-4-methylpyrrolidine-1-carboxylate. InChIKey: MTGCHOAIXJTLDT-IUCAKERBSA-N.
| Molecular formula | C11H21NO3 |
|---|---|
| Molecular weight | 215.29 g/mol |
| IUPAC name | tert-butyl (2S,4S)-2-(hydroxymethyl)-4-methylpyrrolidine-1-carboxylate |
| InChIKey | MTGCHOAIXJTLDT-IUCAKERBSA-N |
| SMILES | C[C@H]1C[C@H](N(C1)C(=O)OC(C)(C)C)CO |
Computed by PubChem (NCBI)