(2S,5S)-1-(2-(1,3-dioxolan-2-yl)phenyl)-2,5-dimethylphospholane, 98% 99%ee
cas: 695816-47-8 — see every product listed under this CAS number, including other names
(2S,5S)-1-(2-(1,3-dioxolan-2-yl)phenyl)-2,5-dimethylphospholane, 98% 99%ee (CAS 695816-47-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A635961-250mg |
| cas | 695816-47-8 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 592.88 Pln | |
| Ambeed | 1g | 1749.88 Pln | |
| Ambeed | 5g | 6806.19 Pln | |
| Chemat | 100mg | 419.60 Pln | |
| Chemat | 250mg | 606.80 Pln | |
| Chemat | 1g | 1826.00 Pln | |
| Chemat | 5g | 7173.20 Pln | |
| BLDpharm | 100mg | 442.09 Pln | |
| BLDpharm | 250mg | 636.47 Pln | |
| BLDpharm | 1g | 1880.47 Pln | |
| BLDpharm | 5g | 7334.11 Pln |
properties
| purity | 98% 99%ee |
|---|---|
| delivery time | 1-2 weeks |
2-[2-[(2S,5S)-2,5-dimethylphospholan-1-yl]phenyl]-1,3-dioxolane (CAS 695816-47-8) is a chemical compound with the molecular formula C15H21O2P and a molecular weight of 264.30 g/mol. IUPAC name: 2-[2-[(2S,5S)-2,5-dimethylphospholan-1-yl]phenyl]-1,3-dioxolane. InChIKey: JAKXTLMNIHPLEU-RYUDHWBXSA-N.
| Molecular formula | C15H21O2P |
|---|---|
| Molecular weight | 264.30 g/mol |
| IUPAC name | 2-[2-[(2S,5S)-2,5-dimethylphospholan-1-yl]phenyl]-1,3-dioxolane |
| InChIKey | JAKXTLMNIHPLEU-RYUDHWBXSA-N |
| SMILES | C[C@H]1CC[C@@H](P1C2=CC=CC=C2C3OCCO3)C |
Computed by PubChem (NCBI)
Synonyms:
(2S,5S)-1-(2-(1,3-dioxolan-2-yl)phenyl)-2,5-dimethylphospholane, (2S,5S)-(+)-1-(2-(1,3-Dioxolan-2-yl)phenyl-2,5-dimethylphospholane, S,S-Me-RajPhos, 2-[2-[(2S,5S)-2,5-dimethylphospholan-1-yl]phenyl]-1,3-dioxolane, (2S,5S)-(+)-1-(2-(1,3-Dioxolan-2-yl)phenyl)-2,5-dimethylphospholane, 2-{2-[(2S,5S)-2,5-Dimethylphospholan-1-yl]phenyl}-1,3-dioxolane