(3',4'-Dichloro-[1,1'-biphenyl]-4-yl)boronic acid, 98%
cas: 1025736-43-9 — see every product listed under this CAS number, including other names
(3',4'-Dichloro-[1,1'-biphenyl]-4-yl)boronic acid, 98% (CAS 1025736-43-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A137239-250mg |
| cas | 1025736-43-9 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 231.31 Pln | |
| Ambeed | 1g | 481.62 Pln | |
| Ambeed | 5g | 1499.56 Pln | |
| Chemat | 100mg | 251.60 Pln | |
| Chemat | 250mg | 342.80 Pln | |
| Chemat | 1g | 765.20 Pln | |
| BLDpharm | 100mg | 197.73 Pln | |
| BLDpharm | 250mg | 247.72 Pln | |
| BLDpharm | 1g | 514.29 Pln | |
| BLDpharm | 5g | 1608.35 Pln | |
| Fluorochem | 100mg | 445.69 Pln | |
| Fluorochem | 250mg | 617.51 Pln | |
| Fluorochem | 1g | 1419.31 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
[4-(3,4-dichlorophenyl)phenyl]boronic acid (CAS 1025736-43-9) is a chemical compound with the molecular formula C12H9BCl2O2 and a molecular weight of 266.9 g/mol. IUPAC name: [4-(3,4-dichlorophenyl)phenyl]boronic acid. InChIKey: HKWYWWYEYYTNGU-UHFFFAOYSA-N.
| Molecular formula | C12H9BCl2O2 |
|---|---|
| Molecular weight | 266.9 g/mol |
| IUPAC name | [4-(3,4-dichlorophenyl)phenyl]boronic acid |
| InChIKey | HKWYWWYEYYTNGU-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C2=CC(=C(C=C2)Cl)Cl)(O)O |
Computed by PubChem (NCBI)
Synonyms:
(3',4'-Dichloro-[1,1'-biphenyl]-4-yl)boronic acid, [4-(3,4-dichlorophenyl)phenyl]boronic acid, Boronic acid, B-(3',4'-dichloro[1,1'-biphenyl]-4-yl)-, {3',4'-dichloro-[1,1'-biphenyl]-4-yl}boronic acid, (3'4'-Dichloro-[11'-biphenyl]-4-yl)boronic acid, C12H9BCl2O2, (3',4'-Dichloro-[1,1'-biphenyl]-4-yl)boronicacid, (3',4'-Dichloro[1,1'-biphenyl]-4-yl)boronic acid