(3,4-Dimethylphenyl)methanol, 98%
cas: 6966-10-5 — see every product listed under this CAS number, including other names
(3,4-Dimethylphenyl)methanol, 98% (CAS 6966-10-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 1g, 250mg. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A153236-5g |
| cas | 6966-10-5 |
| size | 5g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 147.88 Pln | |
| Ambeed | 10g | 225.75 Pln | |
| Ambeed | 25g | 309.19 Pln | |
| Ambeed | 100g | 820.94 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 102.80 Pln | |
| Chemat | 10g | 126.80 Pln | |
| Chemat | 25g | 198.80 Pln | |
| Chemat | 100g | 602.00 Pln | |
| BLDpharm | 250mg | 125.54 Pln | |
| BLDpharm | 1g | 136.64 Pln | |
| BLDpharm | 5g | 153.30 Pln | |
| BLDpharm | 10g | 236.61 Pln | |
| BLDpharm | 25g | 325.47 Pln | |
| BLDpharm | 100g | 880.83 Pln | |
| Fluorochem | 5g | 148.92 Pln | |
| Fluorochem | 10g | 200.99 Pln | |
| Fluorochem | 25g | 305.12 Pln | |
| Fluorochem | 100g | 820.56 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
3,4-dimethylbenzyl alcohol is a methylbenzyl alcohol that is benzyl alcohol substituted by methyl groups at positions 3 and 4. It has a role as a plant metabolite. It is a methylbenzyl alcohol and an aromatic primary alcohol.
Source: ChEBI
| Molecular formula | C9H12O |
|---|---|
| Molecular weight | 136.19 g/mol |
| IUPAC name | (3,4-dimethylphenyl)methanol |
| InChIKey | OKGZCXPDJKKZAP-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)CO)C |
Computed by PubChem (NCBI)
Synonyms:
(3,4-Dimethylphenyl)methanol, Benzenemethanol, 3,4-dimethyl-, InChI=1/C9H12O/c1-7-3-4-9(6-10)5-8(7)2/h3-5,10H,6H2,1-2H, OKGZCXPDJKKZAP-UHFFFAOYSA-N, 3,4 dimethylbenzyl alcohol, 3,4-Dimethylbenzenemethanol, 3,4-Dimethylbenzyl alcohol, 99%, (3,4-dimethylphenyl)methan-1-ol, 3,4-Dimethylbenzyl alcoho, (3,4-Dimethylphenyl);methanol