CAS 1350513-45-9 is the registry number for (3,5-Dimethyl-1-propyl-1H-pyrazol-4-yl)boronic acid, 96%. Offered by: Ambeed. Available pack sizes: 5g.
(3,5-dimethyl-1-propylpyrazol-4-yl)boronic acid (CAS 1350513-45-9) is a chemical compound with the molecular formula C8H15BN2O2 and a molecular weight of 182.03 g/mol. IUPAC name: (3,5-dimethyl-1-propylpyrazol-4-yl)boronic acid. InChIKey: KREBVRXZNKKJRB-UHFFFAOYSA-N.
| Molecular formula | C8H15BN2O2 |
|---|---|
| Molecular weight | 182.03 g/mol |
| IUPAC name | (3,5-dimethyl-1-propylpyrazol-4-yl)boronic acid |
| InChIKey | KREBVRXZNKKJRB-UHFFFAOYSA-N |
| SMILES | B(C1=C(N(N=C1C)CCC)C)(O)O |
Computed by PubChem (NCBI)