cas: 871333-05-0 — see every product listed under this CAS number, including other names
(3-((1H-1,2,4-Triazol-3-yl)carbamoyl)phenyl)boronic acid, ≥95%, ≥95% (CAS 871333-05-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch115TMY-250mg |
| cas | 871333-05-0 |
| size | 250mg |
| availability | 4g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 443.60 Pln | |
| Chemat | 1g | 1086.80 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
[3-(1H-1,2,4-triazol-5-ylcarbamoyl)phenyl]boronic acid (CAS 871333-05-0) is a chemical compound with the molecular formula C9H9BN4O3 and a molecular weight of 232.01 g/mol. IUPAC name: [3-(1H-1,2,4-triazol-5-ylcarbamoyl)phenyl]boronic acid. InChIKey: JXMAEIBAKRAGBL-UHFFFAOYSA-N.
| Molecular formula | C9H9BN4O3 |
|---|---|
| Molecular weight | 232.01 g/mol |
| IUPAC name | [3-(1H-1,2,4-triazol-5-ylcarbamoyl)phenyl]boronic acid |
| InChIKey | JXMAEIBAKRAGBL-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)C(=O)NC2=NC=NN2)(O)O |
Computed by PubChem (NCBI)