cas: 850567-38-3 — see every product listed under this CAS number, including other names
(3-((1H-tetrazol-5-yl)carbamoyl)phenyl)boronic acid hydrochloride 98% (CAS 850567-38-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A758101-250mg |
| cas | 850567-38-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 281.38 Pln | |
| Ambeed | 1g | 648.50 Pln | |
| Ambeed | 5g | 2111.44 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A758101 |
[3-(2H-tetrazol-5-ylcarbamoyl)phenyl]boronic acid;hydrochloride (CAS 850567-38-3) is a chemical compound with the molecular formula C8H9BClN5O3 and a molecular weight of 269.45 g/mol. IUPAC name: [3-(2H-tetrazol-5-ylcarbamoyl)phenyl]boronic acid;hydrochloride. InChIKey: PWSGJXZLSYWEAJ-UHFFFAOYSA-N.
| Molecular formula | C8H9BClN5O3 |
|---|---|
| Molecular weight | 269.45 g/mol |
| IUPAC name | [3-(2H-tetrazol-5-ylcarbamoyl)phenyl]boronic acid;hydrochloride |
| InChIKey | PWSGJXZLSYWEAJ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)C(=O)NC2=NNN=N2)(O)O.Cl |
Computed by PubChem (NCBI)