cas: 871333-06-1 — see every product listed under this CAS number, including other names
(3-((4,5-Dihydrothiazol-2-yl)carbamoyl)phenyl)boronic acid, 98%, 98% (CAS 871333-06-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch115OF4-250mg |
| cas | 871333-06-1 |
| size | 250mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 285.20 Pln | |
| Chemat | 1g | 664.40 Pln | |
| Chemat | 5g | 2162.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
[3-(4,5-dihydro-1,3-thiazol-2-ylcarbamoyl)phenyl]boronic acid (CAS 871333-06-1) is a chemical compound with the molecular formula C10H11BN2O3S and a molecular weight of 250.09 g/mol. IUPAC name: [3-(4,5-dihydro-1,3-thiazol-2-ylcarbamoyl)phenyl]boronic acid. InChIKey: JKXDTFJXMNWUFU-UHFFFAOYSA-N.
| Molecular formula | C10H11BN2O3S |
|---|---|
| Molecular weight | 250.09 g/mol |
| IUPAC name | [3-(4,5-dihydro-1,3-thiazol-2-ylcarbamoyl)phenyl]boronic acid |
| InChIKey | JKXDTFJXMNWUFU-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)C(=O)NC2=NCCS2)(O)O |
Computed by PubChem (NCBI)