cas: 865314-28-9 — see every product listed under this CAS number, including other names
(3-((4-(Tert-butoxycarbonyl)piperazin-1-yl)methyl)phenyl)boronic acid, 95%, 95% (CAS 865314-28-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch120ENW-250mg |
| cas | 865314-28-9 |
| size | 250mg |
| availability | 0.95g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 683.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
[3-[[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]methyl]phenyl]boronic acid (CAS 865314-28-9) is a chemical compound with the molecular formula C16H25BN2O4 and a molecular weight of 320.2 g/mol. IUPAC name: [3-[[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]methyl]phenyl]boronic acid. InChIKey: MFEOKQZFYJRCEP-UHFFFAOYSA-N.
| Molecular formula | C16H25BN2O4 |
|---|---|
| Molecular weight | 320.2 g/mol |
| IUPAC name | [3-[[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]methyl]phenyl]boronic acid |
| InChIKey | MFEOKQZFYJRCEP-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)CN2CCN(CC2)C(=O)OC(C)(C)C)(O)O |
Computed by PubChem (NCBI)