(3-((tert-Butyldiphenylsilyl)oxy)phenyl)boronic acid, 95+%
cas: 855779-05-4 — see every product listed under this CAS number, including other names
(3-((tert-Butyldiphenylsilyl)oxy)phenyl)boronic acid, 95+% (CAS 855779-05-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 50mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A380810-100mg |
| cas | 855779-05-4 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 993.38 Pln | |
| Ambeed | 250mg | 1633.06 Pln | |
| Ambeed | 1g | 4286.38 Pln | |
| Chemat | 50mg | 640.40 Pln | |
| Chemat | 100mg | 1043.60 Pln | |
| Chemat | 250mg | 1725.20 Pln | |
| Chemat | 1g | 4552.40 Pln | |
| BLDpharm | 50mg | 658.68 Pln | |
| BLDpharm | 100mg | 1064.09 Pln | |
| BLDpharm | 250mg | 1752.74 Pln | |
| BLDpharm | 1g | 4618.40 Pln |
properties
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
[3-[tert-butyl(diphenyl)silyl]oxyphenyl]boronic acid (CAS 855779-05-4) is a chemical compound with the molecular formula C22H25BO3Si and a molecular weight of 376.3 g/mol. IUPAC name: [3-[tert-butyl(diphenyl)silyl]oxyphenyl]boronic acid. InChIKey: NNVAKOCPHAISJQ-UHFFFAOYSA-N.
| Molecular formula | C22H25BO3Si |
|---|---|
| Molecular weight | 376.3 g/mol |
| IUPAC name | [3-[tert-butyl(diphenyl)silyl]oxyphenyl]boronic acid |
| InChIKey | NNVAKOCPHAISJQ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)O[Si](C2=CC=CC=C2)(C3=CC=CC=C3)C(C)(C)C)(O)O |
Computed by PubChem (NCBI)
Synonyms:
(3-((tert-Butyldiphenylsilyl)oxy)phenyl)boronic acid, [3-[tert-butyl(diphenyl)silyl]oxyphenyl]boronic acid, (3-((tert-Butyldiphenylsilyl)oxy)phenyl)boronicacid, C22H25BO3Si, (3-{[tert-Butyl(diphenyl)silyl]oxy}phenyl)boronic acid, (3-{[tert-Butyldi(phenyl)silyl]oxy}phenyl)boronic acid, Boronic acid, B-[3-[[(1,1-diMethylethyl)diphenylsilyl]oxy]phenyl]-