cas: 1311166-07-0 — see every product listed under this CAS number, including other names
(3-(2-(Piperidin-1-yl)ethoxy)phenyl)boronic acid 98% (CAS 1311166-07-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A874029-100mg |
| cas | 1311166-07-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 854.31 Pln | |
| Ambeed | 250mg | 1010.06 Pln | |
| Ambeed | 1g | 2428.50 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A874029 |
[3-(2-piperidin-1-ylethoxy)phenyl]boronic acid (CAS 1311166-07-0) is a chemical compound with the molecular formula C13H20BNO3 and a molecular weight of 249.12 g/mol. IUPAC name: [3-(2-piperidin-1-ylethoxy)phenyl]boronic acid. InChIKey: RVGXCTOOQRWXTB-UHFFFAOYSA-N.
| Molecular formula | C13H20BNO3 |
|---|---|
| Molecular weight | 249.12 g/mol |
| IUPAC name | [3-(2-piperidin-1-ylethoxy)phenyl]boronic acid |
| InChIKey | RVGXCTOOQRWXTB-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)OCCN2CCCCC2)(O)O |
Computed by PubChem (NCBI)