cas: 1256345-86-4 — see every product listed under this CAS number, including other names
(3-(Cyclopent-1-en-1-yl)phenyl)boronic acid 98% (CAS 1256345-86-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A717370-100mg |
| cas | 1256345-86-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 281.38 Pln | |
| Ambeed | 250mg | 359.25 Pln | |
| Ambeed | 1g | 759.75 Pln | |
| Ambeed | 5g | 2144.81 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A717370 |
[3-(cyclopenten-1-yl)phenyl]boronic acid (CAS 1256345-86-4) is a chemical compound with the molecular formula C11H13BO2 and a molecular weight of 188.03 g/mol. IUPAC name: [3-(cyclopenten-1-yl)phenyl]boronic acid. InChIKey: SQLOZGPHXKYUCE-UHFFFAOYSA-N.
| Molecular formula | C11H13BO2 |
|---|---|
| Molecular weight | 188.03 g/mol |
| IUPAC name | [3-(cyclopenten-1-yl)phenyl]boronic acid |
| InChIKey | SQLOZGPHXKYUCE-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)C2=CCCC2)(O)O |
Computed by PubChem (NCBI)