cas: 1072952-07-8 — see every product listed under this CAS number, including other names
(3-(Ethylsulfinyl)phenyl)boronic acid, 98% (CAS 1072952-07-8) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F210336-1G |
| cas | 1072952-07-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 1153.78 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(3-ethylsulfinylphenyl)boronic acid (CAS 1072952-07-8) is a chemical compound with the molecular formula C8H11BO3S and a molecular weight of 198.05 g/mol. IUPAC name: (3-ethylsulfinylphenyl)boronic acid. InChIKey: DHBFKULBTXMUOK-UHFFFAOYSA-N.
| Molecular formula | C8H11BO3S |
|---|---|
| Molecular weight | 198.05 g/mol |
| IUPAC name | (3-ethylsulfinylphenyl)boronic acid |
| InChIKey | DHBFKULBTXMUOK-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)S(=O)CC)(O)O |
Computed by PubChem (NCBI)