cas: 78832-65-2 — see every product listed under this CAS number, including other names
(3-(Furan-2-yl)acryloyl)-L-leucylglycyl-L-prolyl-L-alanine, 98%, 98% (CAS 78832-65-2) is a chemical reagent available from Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 250mg, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch116DFG-5mg |
| cas | 78832-65-2 |
| size | 5mg |
| availability | 1.25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5mg | 405.20 Pln | |
| Chemat | 10mg | 602.00 Pln | |
| Chemat | 25mg | 1149.20 Pln | |
| Chemat | 50mg | 1797.20 Pln | |
| Chemat | 250mg | 7557.20 Pln | |
| Chemat | 100mg | 3174.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2S)-2-[[(2S)-1-[2-[[(2S)-2-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]-4-methylpentanoyl]amino]acetyl]pyrrolidine-2-carbonyl]amino]propanoic acid (CAS 78832-65-2) is a chemical compound with the molecular formula C23H32N4O7 and a molecular weight of 476.5 g/mol. IUPAC name: (2S)-2-[[(2S)-1-[2-[[(2S)-2-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]-4-methylpentanoyl]amino]acetyl]pyrrolidine-2-carbonyl]amino]propanoic acid. InChIKey: ZLFQNOJSYZSINX-PVJKAEHXSA-N.
| Molecular formula | C23H32N4O7 |
|---|---|
| Molecular weight | 476.5 g/mol |
| IUPAC name | (2S)-2-[[(2S)-1-[2-[[(2S)-2-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]-4-methylpentanoyl]amino]acetyl]pyrrolidine-2-carbonyl]amino]propanoic acid |
| InChIKey | ZLFQNOJSYZSINX-PVJKAEHXSA-N |
| SMILES | C[C@@H](C(=O)O)NC(=O)[C@@H]1CCCN1C(=O)CNC(=O)[C@H](CC(C)C)NC(=O)/C=C/C2=CC=CO2 |
Computed by PubChem (NCBI)