cas: 397843-71-9 — see every product listed under this CAS number, including other names
(3-(Phenylcarbamoyl)phenyl)boronic acid 98% (CAS 397843-71-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A195069-100mg |
| cas | 397843-71-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 214.62 Pln | |
| Ambeed | 250mg | 259.12 Pln | |
| Ambeed | 1g | 331.44 Pln | |
| Ambeed | 5g | 854.31 Pln | |
| Ambeed | 25g | 2689.94 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A195069 |
[3-(phenylcarbamoyl)phenyl]boronic acid (CAS 397843-71-9) is a chemical compound with the molecular formula C13H12BNO3 and a molecular weight of 241.05 g/mol. IUPAC name: [3-(phenylcarbamoyl)phenyl]boronic acid. InChIKey: ZFEJFNWZHUMGRH-UHFFFAOYSA-N.
| Molecular formula | C13H12BNO3 |
|---|---|
| Molecular weight | 241.05 g/mol |
| IUPAC name | [3-(phenylcarbamoyl)phenyl]boronic acid |
| InChIKey | ZFEJFNWZHUMGRH-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)C(=O)NC2=CC=CC=C2)(O)O |
Computed by PubChem (NCBI)