cas: 175696-71-6 — see every product listed under this CAS number, including other names
(3-(Piperidin-1-yl)phenyl)methanamine (CAS 175696-71-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F720601-100MG |
| cas | 175696-71-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 513.38 Pln | |
| Fluorochem | 250mg | 643.54 Pln | |
| Fluorochem | 1g | 1502.61 Pln | |
| Fluorochem | 5g | 3501.91 Pln | |
| Fluorochem | 10g | 4532.80 Pln | |
| Fluorochem | 25g | 8099.25 Pln |
| delivery time | 3-4 weeks |
|---|
(3-piperidin-1-ylphenyl)methanamine (CAS 175696-71-6) is a chemical compound with the molecular formula C12H18N2 and a molecular weight of 190.28 g/mol. IUPAC name: (3-piperidin-1-ylphenyl)methanamine. InChIKey: BISSHLVDQOLHNQ-UHFFFAOYSA-N.
| Molecular formula | C12H18N2 |
|---|---|
| Molecular weight | 190.28 g/mol |
| IUPAC name | (3-piperidin-1-ylphenyl)methanamine |
| InChIKey | BISSHLVDQOLHNQ-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)C2=CC=CC(=C2)CN |
Computed by PubChem (NCBI)