cas: 850567-34-9 — see every product listed under this CAS number, including other names
(3-(Thiazol-2-ylcarbamoyl)phenyl)boronic acid, 98% (CAS 850567-34-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 25g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A704277-250mg |
| cas | 850567-34-9 |
| size | 250mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 250mg | 597.31 Pln | |
| AmBeed | 25g | 5824.84 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
[3-(1,3-thiazol-2-ylcarbamoyl)phenyl]boronic acid (CAS 850567-34-9) is a chemical compound with the molecular formula C10H9BN2O3S and a molecular weight of 248.07 g/mol. IUPAC name: [3-(1,3-thiazol-2-ylcarbamoyl)phenyl]boronic acid. InChIKey: ORXREXRVDUFDBS-UHFFFAOYSA-N.
| Molecular formula | C10H9BN2O3S |
|---|---|
| Molecular weight | 248.07 g/mol |
| IUPAC name | [3-(1,3-thiazol-2-ylcarbamoyl)phenyl]boronic acid |
| InChIKey | ORXREXRVDUFDBS-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)C(=O)NC2=NC=CS2)(O)O |
Computed by PubChem (NCBI)