cas: 862728-61-8 — see every product listed under this CAS number, including other names
(3-Bromo-1-tert-butyl-1H-pyrazolo[3,4-d]pyrimidin-4-yl)amine, 98%, 98% (CAS 862728-61-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IDZR-100mg |
| cas | 862728-61-8 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 419.60 Pln | |
| Chemat | 250mg | 674.00 Pln | |
| Chemat | 1g | 1720.40 Pln | |
| Chemat | 5g | 5037.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-bromo-1-tert-butylpyrazolo[3,4-d]pyrimidin-4-amine (CAS 862728-61-8) is a chemical compound with the molecular formula C9H12BrN5 and a molecular weight of 270.13 g/mol. IUPAC name: 3-bromo-1-tert-butylpyrazolo[3,4-d]pyrimidin-4-amine. InChIKey: SOSYGGKAIVNKLX-UHFFFAOYSA-N.
| Molecular formula | C9H12BrN5 |
|---|---|
| Molecular weight | 270.13 g/mol |
| IUPAC name | 3-bromo-1-tert-butylpyrazolo[3,4-d]pyrimidin-4-amine |
| InChIKey | SOSYGGKAIVNKLX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)N1C2=NC=NC(=C2C(=N1)Br)N |
Computed by PubChem (NCBI)