cas: 2096339-47-6 — see every product listed under this CAS number, including other names
(3-Butoxy-4-fluoro-5-(trifluoromethyl)phenyl)boronic acid 97% (CAS 2096339-47-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A466182-100mg |
| cas | 2096339-47-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 392.62 Pln | |
| Ambeed | 250mg | 464.94 Pln | |
| Ambeed | 1g | 542.81 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A466182 |
[3-butoxy-4-fluoro-5-(trifluoromethyl)phenyl]boronic acid (CAS 2096339-47-6) is a chemical compound with the molecular formula C11H13BF4O3 and a molecular weight of 280.03 g/mol. IUPAC name: [3-butoxy-4-fluoro-5-(trifluoromethyl)phenyl]boronic acid. InChIKey: LAVWNAWXHBDFEW-UHFFFAOYSA-N.
| Molecular formula | C11H13BF4O3 |
|---|---|
| Molecular weight | 280.03 g/mol |
| IUPAC name | [3-butoxy-4-fluoro-5-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | LAVWNAWXHBDFEW-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)OCCCC)F)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)