cas: 2096334-04-0 — see every product listed under this CAS number, including other names
(3-Chloro-4-(cyclopentyloxy)-5-fluorophenyl)boronic acid 97% (CAS 2096334-04-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A513141-250mg |
| cas | 2096334-04-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 331.44 Pln | |
| Ambeed | 1g | 698.56 Pln | |
| Ambeed | 5g | 1744.31 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A513141 |
(3-chloro-4-cyclopentyloxy-5-fluorophenyl)boronic acid (CAS 2096334-04-0) is a chemical compound with the molecular formula C11H13BClFO3 and a molecular weight of 258.48 g/mol. IUPAC name: (3-chloro-4-cyclopentyloxy-5-fluorophenyl)boronic acid. InChIKey: IUFUIECEFIREMD-UHFFFAOYSA-N.
| Molecular formula | C11H13BClFO3 |
|---|---|
| Molecular weight | 258.48 g/mol |
| IUPAC name | (3-chloro-4-cyclopentyloxy-5-fluorophenyl)boronic acid |
| InChIKey | IUFUIECEFIREMD-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)Cl)OC2CCCC2)F)(O)O |
Computed by PubChem (NCBI)