cas: 850589-44-5 — see every product listed under this CAS number, including other names
(3-Chloro-4-(cyclopropylcarbamoyl)phenyl)boronic acid, 98% (CAS 850589-44-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F228721-250MG |
| cas | 850589-44-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 227.02 Pln | |
| Fluorochem | 1g | 351.98 Pln | |
| Fluorochem | 5g | 1513.03 Pln | |
| Fluorochem | 10g | 2970.85 Pln | |
| Fluorochem | 25g | 7349.51 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
[3-chloro-4-(cyclopropylcarbamoyl)phenyl]boronic acid (CAS 850589-44-5) is a chemical compound with the molecular formula C10H11BClNO3 and a molecular weight of 239.46 g/mol. IUPAC name: [3-chloro-4-(cyclopropylcarbamoyl)phenyl]boronic acid. InChIKey: TUPWHDSMIIRKLY-UHFFFAOYSA-N.
| Molecular formula | C10H11BClNO3 |
|---|---|
| Molecular weight | 239.46 g/mol |
| IUPAC name | [3-chloro-4-(cyclopropylcarbamoyl)phenyl]boronic acid |
| InChIKey | TUPWHDSMIIRKLY-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)C(=O)NC2CC2)Cl)(O)O |
Computed by PubChem (NCBI)