(3-Chloro-4-ethoxy-2-fluorophenyl)boronic acid, 98%
cas: 909122-50-5 — see every product listed under this CAS number, including other names
(3-Chloro-4-ethoxy-2-fluorophenyl)boronic acid, 98% (CAS 909122-50-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100mg, 250mg, 1g, 100g, 500g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A873244-5g |
| cas | 909122-50-5 |
| size | 5g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 159.00 Pln | |
| Ambeed | 10g | 242.44 Pln | |
| Ambeed | 25g | 331.44 Pln | |
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 1g | 93.20 Pln | |
| Chemat | 5g | 174.80 Pln | |
| Chemat | 10g | 280.40 Pln | |
| Chemat | 25g | 597.20 Pln | |
| Chemat | 100g | 736.40 Pln | |
| BLDpharm | 1g | 125.54 Pln | |
| BLDpharm | 5g | 164.41 Pln | |
| BLDpharm | 25g | 347.68 Pln | |
| Fluorochem | 1g | 112.48 Pln | |
| Fluorochem | 5g | 154.13 Pln | |
| Fluorochem | 10g | 242.64 Pln | |
| Fluorochem | 25g | 325.94 Pln | |
| Fluorochem | 100g | 976.76 Pln | |
| Fluorochem | 500g | 3257.20 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
(3-chloro-4-ethoxy-2-fluorophenyl)boronic acid (CAS 909122-50-5) is a chemical compound with the molecular formula C8H9BClFO3 and a molecular weight of 218.42 g/mol. IUPAC name: (3-chloro-4-ethoxy-2-fluorophenyl)boronic acid. InChIKey: BSNGRABEOSVUSC-UHFFFAOYSA-N.
| Molecular formula | C8H9BClFO3 |
|---|---|
| Molecular weight | 218.42 g/mol |
| IUPAC name | (3-chloro-4-ethoxy-2-fluorophenyl)boronic acid |
| InChIKey | BSNGRABEOSVUSC-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)OCC)Cl)F)(O)O |
Computed by PubChem (NCBI)