CAS 2096339-86-3 appears in our catalog under these names: 3-Chloro-5-ethoxy-4-fluorophenylboronic acid, 98%, 3-Chloro-5-ethoxy-4-fluorophenylboronic acid, 97%, 3-CHLORO-5-ETHOXY-4-FLUOROPHENYLBORONIC ACID, 97%, 97%. Offered by: Combi-blocks, Fluorochem, Chemat. Available pack sizes: 1g, 250mg, 100mg.
(3-chloro-5-ethoxy-4-fluorophenyl)boronic acid (CAS 2096339-86-3) is a chemical compound with the molecular formula C8H9BClFO3 and a molecular weight of 218.42 g/mol. IUPAC name: (3-chloro-5-ethoxy-4-fluorophenyl)boronic acid. InChIKey: VKAFYCSFDIBYHK-UHFFFAOYSA-N.
| Molecular formula | C8H9BClFO3 |
|---|---|
| Molecular weight | 218.42 g/mol |
| IUPAC name | (3-chloro-5-ethoxy-4-fluorophenyl)boronic acid |
| InChIKey | VKAFYCSFDIBYHK-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)Cl)F)OCC)(O)O |
Computed by PubChem (NCBI)