(3-Chloronaphthalen-2-yl)boronic acid, 95%
cas: 1873273-39-2 — see every product listed under this CAS number, including other names
(3-Chloronaphthalen-2-yl)boronic acid, 95% (CAS 1873273-39-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1059099-100mg |
| cas | 1873273-39-2 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 220.19 Pln | |
| Ambeed | 250mg | 309.19 Pln | |
| Ambeed | 1g | 709.69 Pln | |
| Ambeed | 5g | 2345.06 Pln | |
| Ambeed | 10g | 3935.94 Pln | |
| BLDpharm | 100mg | 231.05 Pln | |
| BLDpharm | 250mg | 325.47 Pln | |
| BLDpharm | 1g | 758.65 Pln | |
| BLDpharm | 5g | 2524.69 Pln | |
| BLDpharm | 10g | 4240.75 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
(3-chloronaphthalen-2-yl)boronic acid (CAS 1873273-39-2) is a chemical compound with the molecular formula C10H8BClO2 and a molecular weight of 206.43 g/mol. IUPAC name: (3-chloronaphthalen-2-yl)boronic acid. InChIKey: UFWZIXJDUGBBEP-UHFFFAOYSA-N.
| Molecular formula | C10H8BClO2 |
|---|---|
| Molecular weight | 206.43 g/mol |
| IUPAC name | (3-chloronaphthalen-2-yl)boronic acid |
| InChIKey | UFWZIXJDUGBBEP-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=CC=CC=C2C=C1Cl)(O)O |
Computed by PubChem (NCBI)