cas: 1637208-14-0 — see every product listed under this CAS number, including other names
(3-Cyano-4-hydroxyphenyl)boronic acid 97% (CAS 1637208-14-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A414113-250mg |
| cas | 1637208-14-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 381.50 Pln | |
| Ambeed | 1g | 854.31 Pln | |
| Ambeed | 5g | 3107.12 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A414113 |
(3-cyano-4-hydroxyphenyl)boronic acid (CAS 1637208-14-0) is a chemical compound with the molecular formula C7H6BNO3 and a molecular weight of 162.94 g/mol. IUPAC name: (3-cyano-4-hydroxyphenyl)boronic acid. InChIKey: PGIZXBPAULHTKH-UHFFFAOYSA-N.
| Molecular formula | C7H6BNO3 |
|---|---|
| Molecular weight | 162.94 g/mol |
| IUPAC name | (3-cyano-4-hydroxyphenyl)boronic acid |
| InChIKey | PGIZXBPAULHTKH-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)O)C#N)(O)O |
Computed by PubChem (NCBI)