(3-Fluoro-4'-propyl-[1,1'-biphenyl]-4-yl)boronic acid, 97%
cas: 909709-42-8 — see every product listed under this CAS number, including other names
(3-Fluoro-4'-propyl-[1,1'-biphenyl]-4-yl)boronic acid, 97% (CAS 909709-42-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A164281-250mg |
| cas | 909709-42-8 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 136.75 Pln | |
| Ambeed | 1g | 170.12 Pln | |
| Ambeed | 5g | 414.88 Pln | |
| Ambeed | 25g | 1126.88 Pln | |
| Ambeed | 100g | 3602.19 Pln | |
| Chemat | 250mg | 112.40 Pln | |
| Chemat | 1g | 160.40 Pln | |
| Chemat | 5g | 419.60 Pln | |
| Chemat | 25g | 1168.40 Pln | |
| Chemat | 100g | 3376.40 Pln | |
| BLDpharm | 250mg | 142.20 Pln | |
| BLDpharm | 1g | 181.07 Pln | |
| BLDpharm | 5g | 442.09 Pln | |
| BLDpharm | 25g | 1208.49 Pln | |
| BLDpharm | 100g | 3529.89 Pln | |
| Fluorochem | 250mg | 180.16 Pln | |
| Fluorochem | 1g | 268.67 Pln | |
| Fluorochem | 5g | 763.29 Pln | |
| Fluorochem | 25g | 2163.84 Pln | |
| Fluorochem | 100g | 6266.56 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
[2-fluoro-4-(4-propylphenyl)phenyl]boronic acid (CAS 909709-42-8) is a chemical compound with the molecular formula C15H16BFO2 and a molecular weight of 258.10 g/mol. IUPAC name: [2-fluoro-4-(4-propylphenyl)phenyl]boronic acid. InChIKey: XZGCBSYWWZAXRC-UHFFFAOYSA-N.
| Molecular formula | C15H16BFO2 |
|---|---|
| Molecular weight | 258.10 g/mol |
| IUPAC name | [2-fluoro-4-(4-propylphenyl)phenyl]boronic acid |
| InChIKey | XZGCBSYWWZAXRC-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)C2=CC=C(C=C2)CCC)F)(O)O |
Computed by PubChem (NCBI)
Synonyms:
B-(3-Fluoro-4'-propyl(1,1'-biphenyl)-4-yl)boronic acid, (3-Fluoro-4'-propyl-[1,1'-biphenyl]-4-yl)boronic acid, [2-fluoro-4-(4-propylphenyl)phenyl]boronic acid, 3-Fluoro-4'-propyl-4-biphenylboronic Acid, 4'-Propyl-3-fluoro-biphenyl-4-boronic acid, 4'-Propyl-3-fluoro-4-biphenyl boronic acid, {3-fluoro-4'-propyl-[1,1'-biphenyl]-4-yl}boronic acid, Boronic acid, (3-fluoro-4'-propyl[1,1'-biphenyl]-4-yl)-, 3-Fluoro-4'-Propylbiphenyl-4-Boronic Acid, (3-Fluoro-4'-propyl[1,1'-biphenyl]-4-yl)boronic acid