cas: 2091685-35-5 — see every product listed under this CAS number, including other names
(3-Fluoro-4-methoxy-5-(trifluoromethyl)phenyl)methanol 95% (CAS 2091685-35-5) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1654240-50mg |
| cas | 2091685-35-5 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 526.12 Pln | |
| Ambeed | 100mg | 826.50 Pln | |
| Ambeed | 250mg | 1911.19 Pln | |
| Ambeed | 1g | 4642.38 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1654240 |
[3-fluoro-4-methoxy-5-(trifluoromethyl)phenyl]methanol (CAS 2091685-35-5) is a chemical compound with the molecular formula C9H8F4O2 and a molecular weight of 224.15 g/mol. IUPAC name: [3-fluoro-4-methoxy-5-(trifluoromethyl)phenyl]methanol. InChIKey: QIEKZSFGELLSMX-UHFFFAOYSA-N.
| Molecular formula | C9H8F4O2 |
|---|---|
| Molecular weight | 224.15 g/mol |
| IUPAC name | [3-fluoro-4-methoxy-5-(trifluoromethyl)phenyl]methanol |
| InChIKey | QIEKZSFGELLSMX-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1F)CO)C(F)(F)F |
Computed by PubChem (NCBI)