cas: 863248-20-8 — see every product listed under this CAS number, including other names
(3-Morpholinophenyl)boronic acid hydrochloride, 98% (CAS 863248-20-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F244825-1G |
| cas | 863248-20-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 299.91 Pln | |
| Fluorochem | 5g | 883.04 Pln | |
| Fluorochem | 25g | 3283.24 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(3-morpholin-4-ylphenyl)boronic acid;hydrochloride (CAS 863248-20-8) is a chemical compound with the molecular formula C10H15BClNO3 and a molecular weight of 243.50 g/mol. IUPAC name: (3-morpholin-4-ylphenyl)boronic acid;hydrochloride. InChIKey: XYNTWIZVTNRUME-UHFFFAOYSA-N.
| Molecular formula | C10H15BClNO3 |
|---|---|
| Molecular weight | 243.50 g/mol |
| IUPAC name | (3-morpholin-4-ylphenyl)boronic acid;hydrochloride |
| InChIKey | XYNTWIZVTNRUME-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)N2CCOCC2)(O)O.Cl |
Computed by PubChem (NCBI)