cas: 273376-39-9 — see every product listed under this CAS number, including other names
(3-endo)-tert-Butyl 3-(hydroxymethyl)-8-azabicyclo[3.2.1]octane-8-carboxylate, 97%, 97% (CAS 273376-39-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IKQ8-100mg |
| cas | 273376-39-9 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 986.00 Pln | |
| Chemat | 250mg | 1542.80 Pln | |
| Chemat | 500mg | 2526.80 Pln | |
| Chemat | 1g | 3750.80 Pln | |
| Chemat | 5g | 11133.20 Pln | |
| Chemat | 10g | 18554.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl (1S,5R)-3-(hydroxymethyl)-8-azabicyclo[3.2.1]octane-8-carboxylate (CAS 273376-39-9) is a chemical compound with the molecular formula C13H23NO3 and a molecular weight of 241.33 g/mol. IUPAC name: tert-butyl (1S,5R)-3-(hydroxymethyl)-8-azabicyclo[3.2.1]octane-8-carboxylate. InChIKey: WPHYDBXMMSEFTR-FGWVZKOKSA-N.
| Molecular formula | C13H23NO3 |
|---|---|
| Molecular weight | 241.33 g/mol |
| IUPAC name | tert-butyl (1S,5R)-3-(hydroxymethyl)-8-azabicyclo[3.2.1]octane-8-carboxylate |
| InChIKey | WPHYDBXMMSEFTR-FGWVZKOKSA-N |
| SMILES | CC(C)(C)OC(=O)N1[C@@H]2CC[C@H]1CC(C2)CO |
Computed by PubChem (NCBI)