cas: 81487-04-9 — see every product listed under this CAS number, including other names
(3-exo)-8-Methyl-8-azabicyclo[3.2.1]octan-3-amine, 97%, 97% (CAS 81487-04-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11GJJD-100mg |
| cas | 81487-04-9 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 486.80 Pln | |
| Chemat | 250mg | 626.00 Pln | |
| Chemat | 500mg | 1000.40 Pln | |
| Chemat | 1g | 1470.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-amine (CAS 81487-04-9) is a chemical compound with the molecular formula C8H16N2 and a molecular weight of 140.23 g/mol. IUPAC name: (1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-amine. InChIKey: HJGMRAKQWLKWMH-IEESLHIDSA-N.
| Molecular formula | C8H16N2 |
|---|---|
| Molecular weight | 140.23 g/mol |
| IUPAC name | (1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-amine |
| InChIKey | HJGMRAKQWLKWMH-IEESLHIDSA-N |
| SMILES | CN1[C@@H]2CC[C@H]1CC(C2)N |
Computed by PubChem (NCBI)