cas: 144043-17-4 — see every product listed under this CAS number, including other names
(3R)-(-)-1-Benzyl-3-(methylamino)pyrrolidine, 97%, 97% (CAS 144043-17-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112IUO-5g |
| cas | 144043-17-4 |
| size | 5g |
| availability | 8g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 1758.80 Pln | |
| Chemat | 100mg | 318.80 Pln | |
| Chemat | 250mg | 366.80 Pln | |
| Chemat | 1g | 578.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(3R)-1-benzyl-N-methylpyrrolidin-3-amine (CAS 144043-17-4) is a chemical compound with the molecular formula C12H18N2 and a molecular weight of 190.28 g/mol. IUPAC name: (3R)-1-benzyl-N-methylpyrrolidin-3-amine. InChIKey: UEAYAIWNQQWSBK-GFCCVEGCSA-N.
| Molecular formula | C12H18N2 |
|---|---|
| Molecular weight | 190.28 g/mol |
| IUPAC name | (3R)-1-benzyl-N-methylpyrrolidin-3-amine |
| InChIKey | UEAYAIWNQQWSBK-GFCCVEGCSA-N |
| SMILES | CN[C@@H]1CCN(C1)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)