cas: 1629681-80-6 — see every product listed under this CAS number, including other names
(3R)-1-[(2,4-DIMETHOXYPHENYL)METHYL]-5-OXOPYRROLIDINE-3-CARBOXYLIC ACID, 97% (CAS 1629681-80-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F504980-100MG |
| cas | 1629681-80-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 404.04 Pln | |
| Fluorochem | 250mg | 627.92 Pln | |
| Fluorochem | 500mg | 997.58 Pln | |
| Fluorochem | 1g | 1450.55 Pln | |
| Fluorochem | 5g | 4142.31 Pln | |
| Fluorochem | 10g | 6901.75 Pln | |
| Fluorochem | 25g | 10093.34 Pln | |
| Fluorochem | 100g | 26223.08 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
(3R)-1-[(2,4-dimethoxyphenyl)methyl]-5-oxopyrrolidine-3-carboxylic acid (CAS 1629681-80-6) is a chemical compound with the molecular formula C14H17NO5 and a molecular weight of 279.29 g/mol. IUPAC name: (3R)-1-[(2,4-dimethoxyphenyl)methyl]-5-oxopyrrolidine-3-carboxylic acid. InChIKey: OZFGRQLUQFPWPR-SNVBAGLBSA-N.
| Molecular formula | C14H17NO5 |
|---|---|
| Molecular weight | 279.29 g/mol |
| IUPAC name | (3R)-1-[(2,4-dimethoxyphenyl)methyl]-5-oxopyrrolidine-3-carboxylic acid |
| InChIKey | OZFGRQLUQFPWPR-SNVBAGLBSA-N |
| SMILES | COC1=CC(=C(C=C1)CN2C[C@@H](CC2=O)C(=O)O)OC |
Computed by PubChem (NCBI)