cas: 384830-08-4 — see every product listed under this CAS number, including other names
(3R)-1-Boc-3-(iodomethyl)piperidine, 98%, 98% (CAS 384830-08-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch120G04-100mg |
| cas | 384830-08-4 |
| size | 100mg |
| availability | 7g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 443.60 Pln | |
| Chemat | 250mg | 698.00 Pln | |
| Chemat | 1g | 1456.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl (3R)-3-(iodomethyl)piperidine-1-carboxylate (CAS 384830-08-4) is a chemical compound with the molecular formula C11H20INO2 and a molecular weight of 325.19 g/mol. IUPAC name: tert-butyl (3R)-3-(iodomethyl)piperidine-1-carboxylate. InChIKey: GWYLEGFCHNTQTF-VIFPVBQESA-N.
| Molecular formula | C11H20INO2 |
|---|---|
| Molecular weight | 325.19 g/mol |
| IUPAC name | tert-butyl (3R)-3-(iodomethyl)piperidine-1-carboxylate |
| InChIKey | GWYLEGFCHNTQTF-VIFPVBQESA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H](C1)CI |
Computed by PubChem (NCBI)