cas: 724788-29-8 — see every product listed under this CAS number, including other names
(3R,4R)-4-[(tert-Butoxycarbonyl)amino]-3-hydroxypiperidine, 97%, 97% (CAS 724788-29-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11FF7P-100mg |
| cas | 724788-29-8 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 338.00 Pln | |
| Chemat | 250mg | 510.80 Pln | |
| Chemat | 500mg | 750.80 Pln | |
| Chemat | 1g | 1096.40 Pln | |
| Chemat | 5g | 3165.20 Pln | |
| Chemat | 10g | 5574.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-[(3R,4R)-3-hydroxypiperidin-4-yl]carbamate (CAS 724788-29-8) is a chemical compound with the molecular formula C10H20N2O3 and a molecular weight of 216.28 g/mol. IUPAC name: tert-butyl N-[(3R,4R)-3-hydroxypiperidin-4-yl]carbamate. InChIKey: MLTCALYMVICSBJ-HTQZYQBOSA-N.
| Molecular formula | C10H20N2O3 |
|---|---|
| Molecular weight | 216.28 g/mol |
| IUPAC name | tert-butyl N-[(3R,4R)-3-hydroxypiperidin-4-yl]carbamate |
| InChIKey | MLTCALYMVICSBJ-HTQZYQBOSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCNC[C@H]1O |
Computed by PubChem (NCBI)