cas: 1174020-43-9 — see every product listed under this CAS number, including other names
(3R,4R)-tert-Butyl 3-fluoro-4-hydroxypiperidine-1-carboxylate, 95% (CAS 1174020-43-9) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 500mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F465101-50MG |
| cas | 1174020-43-9 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 221.81 Pln | |
| Fluorochem | 100mg | 253.05 Pln | |
| Fluorochem | 250mg | 445.69 Pln | |
| Fluorochem | 500mg | 643.54 Pln | |
| Fluorochem | 1g | 1049.65 Pln | |
| Fluorochem | 5g | 2372.10 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl (3R,4R)-3-fluoro-4-hydroxypiperidine-1-carboxylate (CAS 1174020-43-9) is a chemical compound with the molecular formula C10H18FNO3 and a molecular weight of 219.25 g/mol. IUPAC name: tert-butyl (3R,4R)-3-fluoro-4-hydroxypiperidine-1-carboxylate. InChIKey: XRNLYXKYODGLMI-HTQZYQBOSA-N.
| Molecular formula | C10H18FNO3 |
|---|---|
| Molecular weight | 219.25 g/mol |
| IUPAC name | tert-butyl (3R,4R)-3-fluoro-4-hydroxypiperidine-1-carboxylate |
| InChIKey | XRNLYXKYODGLMI-HTQZYQBOSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H]([C@@H](C1)F)O |
Computed by PubChem (NCBI)