cas: 1260612-08-5 — see every product listed under this CAS number, including other names
(3R,4R)-tert-Butyl 4-amino-3-fluoropiperidine-1-carboxylate, 98%, 98% (CAS 1260612-08-5) is a chemical reagent available from Chemat. Available pack sizes: 500mg, 100g, 250g, 500g, 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111QW0-500mg |
| cas | 1260612-08-5 |
| size | 500mg |
| availability | 500g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 500mg | 256.40 Pln | |
| Chemat | 100g | 7067.60 Pln | |
| Chemat | 250g | 13346.00 Pln | |
| Chemat | 500g | 20798.40 Pln | |
| Chemat | 100mg | 126.80 Pln | |
| Chemat | 250mg | 165.20 Pln | |
| Chemat | 1g | 338.00 Pln | |
| Chemat | 5g | 890.00 Pln | |
| Chemat | 10g | 1576.40 Pln | |
| Chemat | 25g | 3165.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl (3R,4R)-4-amino-3-fluoropiperidine-1-carboxylate (CAS 1260612-08-5) is a chemical compound with the molecular formula C10H19FN2O2 and a molecular weight of 218.27 g/mol. IUPAC name: tert-butyl (3R,4R)-4-amino-3-fluoropiperidine-1-carboxylate. InChIKey: ZQRYPCAUVKVMLZ-HTQZYQBOSA-N.
| Molecular formula | C10H19FN2O2 |
|---|---|
| Molecular weight | 218.27 g/mol |
| IUPAC name | tert-butyl (3R,4R)-4-amino-3-fluoropiperidine-1-carboxylate |
| InChIKey | ZQRYPCAUVKVMLZ-HTQZYQBOSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H]([C@@H](C1)F)N |
Computed by PubChem (NCBI)