(3R,4R,5S,6R)-3-Amino-6-(hydroxymethyl)tetrahydro-2H-pyran-2,4,5-triol hydrochloride, 95%, 95%
cas: 1078691-95-8 — see every product listed under this CAS number, including other names
(3R,4R,5S,6R)-3-Amino-6-(hydroxymethyl)tetrahydro-2H-pyran-2,4,5-triol hydrochloride, 95%, 95% (CAS 1078691-95-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch129X5B-100mg |
| cas | 1078691-95-8 |
| size | 100mg |
| availability | 15g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 208.40 Pln | |
| Chemat | 250mg | 362.00 Pln | |
| Chemat | 1g | 578.00 Pln | |
| Chemat | 5g | 942.80 Pln | |
| Chemat | 10g | 1562.00 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(3R,4R,5S,6R)-3-amino-6-(hydroxymethyl)oxane-2,4,5-triol;hydrochloride (CAS 1078691-95-8) is a chemical compound with the molecular formula C6H14ClNO5 and a molecular weight of 215.63 g/mol. IUPAC name: (3R,4R,5S,6R)-3-amino-6-(hydroxymethyl)oxane-2,4,5-triol;hydrochloride. InChIKey: QKPLRMLTKYXDST-NSEZLWDYSA-N.
| Molecular formula | C6H14ClNO5 |
|---|---|
| Molecular weight | 215.63 g/mol |
| IUPAC name | (3R,4R,5S,6R)-3-amino-6-(hydroxymethyl)oxane-2,4,5-triol;hydrochloride |
| InChIKey | QKPLRMLTKYXDST-NSEZLWDYSA-N |
| SMILES | C([C@@H]1[C@H]([C@@H]([C@H](C(O1)O)N)O)O)O.Cl |
Computed by PubChem (NCBI)
Synonyms:
2-Amino-2-deoxyglucose hydrochloride, (3R,4R,5S,6R)-3-amino-6-(hydroxymethyl)oxane-2,4,5-triol hydrochloride, 2-Amino-2-deoxyglucose (hydrochloride), D(+)-Glucosamine hydrochloride, (3R,4R,5S,6R)-3-amino-6-(hydroxymethyl)oxane-2,4,5-triol;hydrochloride, Glucosamine hydrochloride; 2-Amino-2-deoxy-d-glucopyranose hydrochloride, GlcN.HCl, glucosamine HCl salt, Glucosamine-HCl salt, 2-Amino-2-deoxy-D-glucopyranose Hydrochloride