cas: 1174020-29-1 — see every product listed under this CAS number, including other names
(3R,4S)-1-Boc-3-amino-4-hydroxy-pyrrolidine, 98% (CAS 1174020-29-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F467828-100MG |
| cas | 1174020-29-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 591.48 Pln | |
| Fluorochem | 250mg | 1028.82 Pln | |
| Fluorochem | 1g | 2939.61 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl (3R,4S)-3-amino-4-hydroxypyrrolidine-1-carboxylate (CAS 1174020-29-1) is a chemical compound with the molecular formula C9H18N2O3 and a molecular weight of 202.25 g/mol. IUPAC name: tert-butyl (3R,4S)-3-amino-4-hydroxypyrrolidine-1-carboxylate. InChIKey: MOZOQDNRVPHFOO-RQJHMYQMSA-N.
| Molecular formula | C9H18N2O3 |
|---|---|
| Molecular weight | 202.25 g/mol |
| IUPAC name | tert-butyl (3R,4S)-3-amino-4-hydroxypyrrolidine-1-carboxylate |
| InChIKey | MOZOQDNRVPHFOO-RQJHMYQMSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]([C@H](C1)O)N |
Computed by PubChem (NCBI)