cas: 267230-44-4 — see every product listed under this CAS number, including other names
(3R,4S)-4-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-1-(tert-butoxycarbonyl)pyrrolidine-3-carboxylic acid, 95% (CAS 267230-44-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 250mg, 5g, 100mg, 500mg, 10g. Offered by: Combi-blocks, Fluorochem.
| brand | Combi-blocks |
|---|---|
| catalog number | QM-6702-1g |
| cas | 267230-44-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 1g | price on request | |
| Combi-blocks | 250mg | price on request | |
| Combi-blocks | 5g | price on request | |
| Fluorochem | 100mg | 1559.89 Pln | |
| Fluorochem | 250mg | 2439.78 Pln | |
| Fluorochem | 500mg | 4012.15 Pln | |
| Fluorochem | 1g | 5980.20 Pln | |
| Fluorochem | 5g | 17793.75 Pln | |
| Fluorochem | 10g | 29612.51 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
(3R,4S)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-3-carboxylic acid (CAS 267230-44-4) is a chemical compound with the molecular formula C25H28N2O6 and a molecular weight of 452.5 g/mol. IUPAC name: (3R,4S)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-3-carboxylic acid. InChIKey: MDJLYIHNKUJSBA-TZIWHRDSSA-N.
| Molecular formula | C25H28N2O6 |
|---|---|
| Molecular weight | 452.5 g/mol |
| IUPAC name | (3R,4S)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-3-carboxylic acid |
| InChIKey | MDJLYIHNKUJSBA-TZIWHRDSSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]([C@@H](C1)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C(=O)O |
Computed by PubChem (NCBI)