cas: 149198-47-0 — see every product listed under this CAS number, including other names
(3R,4S)-tert-Butyl 2-oxo-4-phenyl-3-((triethylsilyl)oxy)azetidine-1-carboxylate 99% (CAS 149198-47-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A326791-1g |
| cas | 149198-47-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 292.50 Pln | |
| Ambeed | 25g | 837.62 Pln |
| purity | 99% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A326791 |
Tert-butyl (3R,4S)-2-oxo-4-phenyl-3-triethylsilyloxyazetidine-1-carboxylate (CAS 149198-47-0) is a chemical compound with the molecular formula C20H31NO4Si and a molecular weight of 377.5 g/mol. IUPAC name: tert-butyl (3R,4S)-2-oxo-4-phenyl-3-triethylsilyloxyazetidine-1-carboxylate. InChIKey: LHTDXUKSFSMGCA-DLBZAZTESA-N.
| Molecular formula | C20H31NO4Si |
|---|---|
| Molecular weight | 377.5 g/mol |
| IUPAC name | tert-butyl (3R,4S)-2-oxo-4-phenyl-3-triethylsilyloxyazetidine-1-carboxylate |
| InChIKey | LHTDXUKSFSMGCA-DLBZAZTESA-N |
| SMILES | CC[Si](CC)(CC)O[C@@H]1[C@@H](N(C1=O)C(=O)OC(C)(C)C)C2=CC=CC=C2 |
Computed by PubChem (NCBI)