cas: 907544-17-6 — see every product listed under this CAS number, including other names
(3R,4S)-tert-Butyl 4-amino-3-fluoropiperidine-1-carboxylate, 97%, 97% (CAS 907544-17-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IG0Y-100mg |
| cas | 907544-17-6 |
| size | 100mg |
| availability | 250g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 131.60 Pln | |
| Chemat | 250mg | 198.80 Pln | |
| Chemat | 500mg | 323.60 Pln | |
| Chemat | 1g | 371.60 Pln | |
| Chemat | 5g | 1096.40 Pln | |
| Chemat | 10g | 1922.00 Pln | |
| Chemat | 25g | 3851.60 Pln | |
| Chemat | 50g | 4336.40 Pln | |
| Chemat | 100g | 6626.00 Pln | |
| Chemat | 250g | 14450.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl (3R,4S)-4-amino-3-fluoropiperidine-1-carboxylate (CAS 907544-17-6) is a chemical compound with the molecular formula C10H19FN2O2 and a molecular weight of 218.27 g/mol. IUPAC name: tert-butyl (3R,4S)-4-amino-3-fluoropiperidine-1-carboxylate. InChIKey: ZQRYPCAUVKVMLZ-SFYZADRCSA-N.
| Molecular formula | C10H19FN2O2 |
|---|---|
| Molecular weight | 218.27 g/mol |
| IUPAC name | tert-butyl (3R,4S)-4-amino-3-fluoropiperidine-1-carboxylate |
| InChIKey | ZQRYPCAUVKVMLZ-SFYZADRCSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H]([C@@H](C1)F)N |
Computed by PubChem (NCBI)