CAS 374791-05-6 is the registry number for (3R,6R)-2,7-Dimethyl-3,6-octanediol, 98%, 98%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g.
(3R,6R)-2,7-dimethyloctane-3,6-diol (CAS 374791-05-6) is a chemical compound with the molecular formula C10H22O2 and a molecular weight of 174.28 g/mol. IUPAC name: (3R,6R)-2,7-dimethyloctane-3,6-diol. InChIKey: IIEGQVRKIRPFFP-NXEZZACHSA-N.
| Molecular formula | C10H22O2 |
|---|---|
| Molecular weight | 174.28 g/mol |
| IUPAC name | (3R,6R)-2,7-dimethyloctane-3,6-diol |
| InChIKey | IIEGQVRKIRPFFP-NXEZZACHSA-N |
| SMILES | CC(C)[C@@H](CC[C@H](C(C)C)O)O |
Computed by PubChem (NCBI)