cas: 955137-85-6 — see every product listed under this CAS number, including other names
(3S,4R)-1-(tert-Butoxycarbonyl)-4-(4-(trifluoromethyl)phenyl)pyrrolidine-3-carboxylic acid, 97% (CAS 955137-85-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F216955-100MG |
| cas | 955137-85-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 372.80 Pln | |
| Fluorochem | 250mg | 591.48 Pln | |
| Fluorochem | 1g | 1252.70 Pln | |
| Fluorochem | 5g | 5220.05 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
(3S,4R)-1-[(2-methylpropan-2-yl)oxycarbonyl]-4-[4-(trifluoromethyl)phenyl]pyrrolidine-3-carboxylic acid (CAS 955137-85-6) is a chemical compound with the molecular formula C17H20F3NO4 and a molecular weight of 359.34 g/mol. IUPAC name: (3S,4R)-1-[(2-methylpropan-2-yl)oxycarbonyl]-4-[4-(trifluoromethyl)phenyl]pyrrolidine-3-carboxylic acid. InChIKey: QCXSJRUEERTHEK-QWHCGFSZSA-N.
| Molecular formula | C17H20F3NO4 |
|---|---|
| Molecular weight | 359.34 g/mol |
| IUPAC name | (3S,4R)-1-[(2-methylpropan-2-yl)oxycarbonyl]-4-[4-(trifluoromethyl)phenyl]pyrrolidine-3-carboxylic acid |
| InChIKey | QCXSJRUEERTHEK-QWHCGFSZSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]([C@@H](C1)C(=O)O)C2=CC=C(C=C2)C(F)(F)F |
Computed by PubChem (NCBI)