cas: 346610-79-5 — see every product listed under this CAS number, including other names
(3S,4R)-1-[(tert-Butoxy)carbonyl]-4-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}pyrrolidine-3-carboxylic acid, 98% (CAS 346610-79-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F614236-100MG |
| cas | 346610-79-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 851.80 Pln | |
| Fluorochem | 250mg | 1362.04 Pln | |
| Fluorochem | 1g | 3309.27 Pln | |
| Fluorochem | 5g | 11379.34 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(3S,4R)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-3-carboxylic acid (CAS 346610-79-5) is a chemical compound with the molecular formula C25H28N2O6 and a molecular weight of 452.5 g/mol. IUPAC name: (3S,4R)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-3-carboxylic acid. InChIKey: MDJLYIHNKUJSBA-FPOVZHCZSA-N.
| Molecular formula | C25H28N2O6 |
|---|---|
| Molecular weight | 452.5 g/mol |
| IUPAC name | (3S,4R)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-3-carboxylic acid |
| InChIKey | MDJLYIHNKUJSBA-FPOVZHCZSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]([C@H](C1)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C(=O)O |
Computed by PubChem (NCBI)