(3S,4R)-3-((Benzo[d][1,3]dioxol-5-yloxy)methyl)-4-(4-fluorophenyl)-1-(3-fluoropropyl)piperidine, 98%
cas: 138135-14-5 — see every product listed under this CAS number, including other names
(3S,4R)-3-((Benzo[d][1,3]dioxol-5-yloxy)methyl)-4-(4-fluorophenyl)-1-(3-fluoropropyl)piperidine, 98% (CAS 138135-14-5) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 250mg, 1g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1278002-10mg |
| cas | 138135-14-5 |
| size | 10mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10mg | 492.75 Pln | |
| Ambeed | 25mg | 871.00 Pln | |
| Ambeed | 50mg | 1427.25 Pln | |
| Ambeed | 100mg | 2372.88 Pln | |
| Ambeed | 250mg | 4208.50 Pln | |
| Ambeed | 1g | 11228.38 Pln | |
| BLDpharm | 10mg | 525.40 Pln | |
| BLDpharm | 25mg | 930.81 Pln | |
| BLDpharm | 50mg | 1530.60 Pln | |
| BLDpharm | 100mg | 2552.46 Pln | |
| BLDpharm | 250mg | 4529.54 Pln | |
| BLDpharm | 1g | 12104.65 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
(3S,4R)-3-(1,3-benzodioxol-5-yloxymethyl)-4-(4-fluorophenyl)-1-(3-fluoropropyl)piperidine (CAS 138135-14-5) is a chemical compound with the molecular formula C22H25F2NO3 and a molecular weight of 389.4 g/mol. IUPAC name: (3S,4R)-3-(1,3-benzodioxol-5-yloxymethyl)-4-(4-fluorophenyl)-1-(3-fluoropropyl)piperidine. InChIKey: FUCBTTRMHIHFNU-PXNSSMCTSA-N.
| Molecular formula | C22H25F2NO3 |
|---|---|
| Molecular weight | 389.4 g/mol |
| IUPAC name | (3S,4R)-3-(1,3-benzodioxol-5-yloxymethyl)-4-(4-fluorophenyl)-1-(3-fluoropropyl)piperidine |
| InChIKey | FUCBTTRMHIHFNU-PXNSSMCTSA-N |
| SMILES | C1CN(C[C@H]([C@@H]1C2=CC=C(C=C2)F)COC3=CC4=C(C=C3)OCO4)CCCF |
Computed by PubChem (NCBI)